C11H22N2O5 — CID 108525813
N'-(2,2-dimethoxyethyl)-N-(5-hydroxypentyl)oxamide (PubChem CID 108525813) has the molecular formula C11H22N2O5 and a molecular weight of 262.31 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N-(5-hydroxypentyl)oxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)-N-(5-hydroxypentyl)oxamide |
|---|---|
| PubChem CID | 108525813 |
| Molecular Formula | C11H22N2O5 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N-(5-hydroxypentyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)NCCCCCO)OC |
| InChI | InChI=1S/C11H22N2O5/c1-17-9(18-2)8-13-11(16)10(15)12-6-4-3-5-7-14/h9,14H,3-8H2,1-2H3,(H,12,15)(H,13,16) |
| InChIKey | PQHXZBVTSASTBB-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|