C10H18N2O3 — CID 108525776
N-(5-hydroxypentyl)-N'-prop-2-enyloxamide (PubChem CID 108525776) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N'-prop-2-enyloxamide.
| Compound Name | N-(5-hydroxypentyl)-N'-prop-2-enyloxamide |
|---|---|
| PubChem CID | 108525776 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-(5-hydroxypentyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCCCCO |
| InChI | InChI=1S/C10H18N2O3/c1-2-6-11-9(14)10(15)12-7-4-3-5-8-13/h2,13H,1,3-8H2,(H,11,14)(H,12,15) |
| InChIKey | URXIQLKROBJVIZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|