About N-(5-hydroxypentyl)-N'-prop-2-enyloxamide
N-(5-hydroxypentyl)-N'-prop-2-enyloxamide (PubChem CID 108525776) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N'-prop-2-enyloxamide.
Molecular Properties
| Compound Name | N-(5-hydroxypentyl)-N'-prop-2-enyloxamide |
| PubChem CID | 108525776 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-(5-hydroxypentyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCCCCO |
| InChI | InChI=1S/C10H18N2O3/c1-2-6-11-9(14)10(15)12-7-4-3-5-8-13/h2,13H,1,3-8H2,(H,11,14)(H,12,15) |
| InChIKey | URXIQLKROBJVIZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(5-hydroxypentyl)-N'-prop-2-enyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-hydroxypentyl)-N'-prop-2-enyloxamide?
The IUPAC name of N-(5-hydroxypentyl)-N'-prop-2-enyloxamide (CID 108525776) is N-(5-hydroxypentyl)-N'-prop-2-enyloxamide.
What is the SMILES notation for N-(5-hydroxypentyl)-N'-prop-2-enyloxamide?
The canonical SMILES for N-(5-hydroxypentyl)-N'-prop-2-enyloxamide is C=CCNC(=O)C(=O)NCCCCCO.
What is the InChIKey of N-(5-hydroxypentyl)-N'-prop-2-enyloxamide?
The InChIKey is URXIQLKROBJVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-2-6-11-9(14)10(15)12-7-4-3-5-8-13/h2,13H,1,3-8H2,(H,11,14)(H,12,15).
What are the key properties of N-(5-hydroxypentyl)-N'-prop-2-enyloxamide?
N-(5-hydroxypentyl)-N'-prop-2-enyloxamide has a molecular weight of 214.26 g/mol, XLogP of -0.43, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-hydroxypentyl)-N'-prop-2-enyloxamide is sourced from PubChem (CID 108525776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).