C9H15N3O3 — CID 108526430
N-(3-formamidopropyl)-N'-prop-2-enyloxamide (PubChem CID 108526430) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is N-(3-formamidopropyl)-N'-prop-2-enyloxamide.
| Compound Name | N-(3-formamidopropyl)-N'-prop-2-enyloxamide |
|---|---|
| PubChem CID | 108526430 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | N-(3-formamidopropyl)-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCCNC=O |
| InChI | InChI=1S/C9H15N3O3/c1-2-4-11-8(14)9(15)12-6-3-5-10-7-13/h2,7H,1,3-6H2,(H,10,13)(H,11,14)(H,12,15) |
| InChIKey | OBJPRVFXTUGKFF-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|