C16H22N2O2 — CID 175865307
(E)-2,7-dimethylidene-N,N'-bis(prop-2-enyl)oct-4-enediamide (PubChem CID 175865307) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (E)-2,7-dimethylidene-N,N'-bis(prop-2-enyl)oct-4-enediamide.
| Compound Name | (E)-2,7-dimethylidene-N,N'-bis(prop-2-enyl)oct-4-enediamide |
|---|---|
| PubChem CID | 175865307 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (E)-2,7-dimethylidene-N,N'-bis(prop-2-enyl)oct-4-enediamide |
| SMILES | C=CCNC(=O)C(=C)C/C=C/CC(=C)C(=O)NCC=C |
| InChI | InChI=1S/C16H22N2O2/c1-5-11-17-15(19)13(3)9-7-8-10-14(4)16(20)18-12-6-2/h5-8H,1-4,9-12H2,(H,17,19)(H,18,20)/b8-7+ |
| InChIKey | DLVGTDYVTSHHTJ-BQYQJAHWSA-N |
| XLogP | 2.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|