C7H11NO5S — CID 87188026
2-(prop-2-enylcarbamoyl)prop-2-enyl hydrogen sulfate (PubChem CID 87188026) has the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. Its IUPAC name is 2-(prop-2-enylcarbamoyl)prop-2-enyl hydrogen sulfate.
| Compound Name | 2-(prop-2-enylcarbamoyl)prop-2-enyl hydrogen sulfate |
|---|---|
| PubChem CID | 87188026 |
| Molecular Formula | C7H11NO5S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-(prop-2-enylcarbamoyl)prop-2-enyl hydrogen sulfate |
| SMILES | C=CCNC(=O)C(=C)COS(=O)(=O)O |
| InChI | InChI=1S/C7H11NO5S/c1-3-4-8-7(9)6(2)5-13-14(10,11)12/h3H,1-2,4-5H2,(H,8,9)(H,10,11,12) |
| InChIKey | JDOIWNPUYMWRJU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|