C18H33NO2 — CID 135129592
N-prop-2-enyl-2-(2,4,6-trimethyloctan-2-yloxymethyl)prop-2-enamide (PubChem CID 135129592) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is N-prop-2-enyl-2-(2,4,6-trimethyloctan-2-yloxymethyl)prop-2-enamide.
| Compound Name | N-prop-2-enyl-2-(2,4,6-trimethyloctan-2-yloxymethyl)prop-2-enamide |
|---|---|
| PubChem CID | 135129592 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | N-prop-2-enyl-2-(2,4,6-trimethyloctan-2-yloxymethyl)prop-2-enamide |
| SMILES | C=CCNC(=O)C(=C)COC(C)(C)CC(C)CC(C)CC |
| InChI | InChI=1S/C18H33NO2/c1-8-10-19-17(20)16(5)13-21-18(6,7)12-15(4)11-14(3)9-2/h8,14-15H,1,5,9-13H2,2-4,6-7H3,(H,19,20) |
| InChIKey | DTZPJGNVHZXYAR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|