C10H15NO — CID 174329237
2-methyl-N-prop-2-enylhexa-2,5-dienamide (PubChem CID 174329237) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-methyl-N-prop-2-enylhexa-2,5-dienamide.
| Compound Name | 2-methyl-N-prop-2-enylhexa-2,5-dienamide |
|---|---|
| PubChem CID | 174329237 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-methyl-N-prop-2-enylhexa-2,5-dienamide |
| SMILES | C=CCC=C(C)C(=O)NCC=C |
| InChI | InChI=1S/C10H15NO/c1-4-6-7-9(3)10(12)11-8-5-2/h4-5,7H,1-2,6,8H2,3H3,(H,11,12) |
| InChIKey | LKIFFTHOMMIHLG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|