C7H11NO2 — CID 173014431
N-hydroxy-2-methylhexa-2,5-dienamide (PubChem CID 173014431) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is N-hydroxy-2-methylhexa-2,5-dienamide.
| Compound Name | N-hydroxy-2-methylhexa-2,5-dienamide |
|---|---|
| PubChem CID | 173014431 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | N-hydroxy-2-methylhexa-2,5-dienamide |
| SMILES | C=CCC=C(C)C(=O)NO |
| InChI | InChI=1S/C7H11NO2/c1-3-4-5-6(2)7(9)8-10/h3,5,10H,1,4H2,2H3,(H,8,9) |
| InChIKey | JIYNAZMCSLRKDE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|