C6H9NO4S — CID 87500396
3-oxo-3-(prop-2-enylamino)prop-1-ene-2-sulfonic acid (PubChem CID 87500396) has the molecular formula C6H9NO4S and a molecular weight of 191.21 g/mol. Its IUPAC name is 3-oxo-3-(prop-2-enylamino)prop-1-ene-2-sulfonic acid.
| Compound Name | 3-oxo-3-(prop-2-enylamino)prop-1-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 87500396 |
| Molecular Formula | C6H9NO4S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 3-oxo-3-(prop-2-enylamino)prop-1-ene-2-sulfonic acid |
| SMILES | C=CCNC(=O)C(=C)S(=O)(=O)O |
| InChI | InChI=1S/C6H9NO4S/c1-3-4-7-6(8)5(2)12(9,10)11/h3H,1-2,4H2,(H,7,8)(H,9,10,11) |
| InChIKey | HBJIFNNJXDWDBL-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|