About prop-2-enylcarbamic acid;hydrate
prop-2-enylcarbamic acid;hydrate (PubChem CID 173458484) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is prop-2-enylcarbamic acid;hydrate.
Molecular Properties
| Compound Name | prop-2-enylcarbamic acid;hydrate |
| PubChem CID | 173458484 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | prop-2-enylcarbamic acid;hydrate |
| SMILES | C=CCNC(=O)O.O |
| InChI | InChI=1S/C4H7NO2.H2O/c1-2-3-5-4(6)7;/h2,5H,1,3H2,(H,6,7);1H2 |
| InChIKey | AHWCTWHOAWSOMH-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 80.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enylcarbamic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enylcarbamic acid;hydrate?
The IUPAC name of prop-2-enylcarbamic acid;hydrate (CID 173458484) is prop-2-enylcarbamic acid;hydrate.
What is the SMILES notation for prop-2-enylcarbamic acid;hydrate?
The canonical SMILES for prop-2-enylcarbamic acid;hydrate is C=CCNC(=O)O.O.
What is the InChIKey of prop-2-enylcarbamic acid;hydrate?
The InChIKey is AHWCTWHOAWSOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.H2O/c1-2-3-5-4(6)7;/h2,5H,1,3H2,(H,6,7);1H2.
What are the key properties of prop-2-enylcarbamic acid;hydrate?
prop-2-enylcarbamic acid;hydrate has a molecular weight of 119.12 g/mol, XLogP of -0.38, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enylcarbamic acid;hydrate is sourced from PubChem (CID 173458484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).