C9H16N2O4 — CID 87552237
4-hydroxy-2-methylidenebutanamide;prop-2-enylcarbamic acid (PubChem CID 87552237) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-hydroxy-2-methylidenebutanamide;prop-2-enylcarbamic acid.
| Compound Name | 4-hydroxy-2-methylidenebutanamide;prop-2-enylcarbamic acid |
|---|---|
| PubChem CID | 87552237 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 4-hydroxy-2-methylidenebutanamide;prop-2-enylcarbamic acid |
| SMILES | C=C(CCO)C(N)=O.C=CCNC(=O)O |
| InChI | InChI=1S/C5H9NO2.C4H7NO2/c1-4(2-3-7)5(6)8;1-2-3-5-4(6)7/h7H,1-3H2,(H2,6,8);2,5H,1,3H2,(H,6,7) |
| InChIKey | AHUCIEHPSDOHTJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|