C11H19NO5 — CID 174416041
2-hydroxyacetic acid;2-methylidenepent-4-enamide;prop-2-en-1-ol (PubChem CID 174416041) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-hydroxyacetic acid;2-methylidenepent-4-enamide;prop-2-en-1-ol.
| Compound Name | 2-hydroxyacetic acid;2-methylidenepent-4-enamide;prop-2-en-1-ol |
|---|---|
| PubChem CID | 174416041 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-hydroxyacetic acid;2-methylidenepent-4-enamide;prop-2-en-1-ol |
| SMILES | C=CCC(=C)C(N)=O.C=CCO.O=C(O)CO |
| InChI | InChI=1S/C6H9NO.C3H6O.C2H4O3/c1-3-4-5(2)6(7)8;1-2-3-4;3-1-2(4)5/h3H,1-2,4H2,(H2,7,8);2,4H,1,3H2;3H,1H2,(H,4,5) |
| InChIKey | YNNPTOXMBQDFGL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|