About 2-methylprop-2-enamide;prop-2-en-1-ol
2-methylprop-2-enamide;prop-2-en-1-ol (PubChem CID 174804195) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-methylprop-2-enamide;prop-2-en-1-ol.
Molecular Properties
| Compound Name | 2-methylprop-2-enamide;prop-2-en-1-ol |
| PubChem CID | 174804195 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-methylprop-2-enamide;prop-2-en-1-ol |
| SMILES | C=C(C)C(N)=O.C=CCO |
| InChI | InChI=1S/C4H7NO.C3H6O/c1-3(2)4(5)6;1-2-3-4/h1H2,2H3,(H2,5,6);2,4H,1,3H2 |
| InChIKey | ONIYKCAFMUNUFZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enamide;prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enamide;prop-2-en-1-ol?
The IUPAC name of 2-methylprop-2-enamide;prop-2-en-1-ol (CID 174804195) is 2-methylprop-2-enamide;prop-2-en-1-ol.
What is the SMILES notation for 2-methylprop-2-enamide;prop-2-en-1-ol?
The canonical SMILES for 2-methylprop-2-enamide;prop-2-en-1-ol is C=C(C)C(N)=O.C=CCO.
What is the InChIKey of 2-methylprop-2-enamide;prop-2-en-1-ol?
The InChIKey is ONIYKCAFMUNUFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C3H6O/c1-3(2)4(5)6;1-2-3-4/h1H2,2H3,(H2,5,6);2,4H,1,3H2.
What are the key properties of 2-methylprop-2-enamide;prop-2-en-1-ol?
2-methylprop-2-enamide;prop-2-en-1-ol has a molecular weight of 143.19 g/mol, XLogP of 0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enamide;prop-2-en-1-ol is sourced from PubChem (CID 174804195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).