About sodium;2-methylprop-2-enamide;propane
sodium;2-methylprop-2-enamide;propane (PubChem CID 159451329) has the molecular formula C7H14NNaO
and a molecular weight of 151.18 g/mol. Its IUPAC name is sodium;2-methylprop-2-enamide;propane.
Molecular Properties
| Compound Name | sodium;2-methylprop-2-enamide;propane |
| PubChem CID | 159451329 |
| Molecular Formula | C7H14NNaO |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | sodium;2-methylprop-2-enamide;propane |
| SMILES | C=C(C)C(N)=O.C[CH-]C.[Na+] |
| InChI | InChI=1S/C4H7NO.C3H7.Na/c1-3(2)4(5)6;1-3-2;/h1H2,2H3,(H2,5,6);3H,1-2H3;/q;-1;+1 |
| InChIKey | LDZVTKAWYWHWGA-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methylprop-2-enamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methylprop-2-enamide;propane?
The IUPAC name of sodium;2-methylprop-2-enamide;propane (CID 159451329) is sodium;2-methylprop-2-enamide;propane.
What is the SMILES notation for sodium;2-methylprop-2-enamide;propane?
The canonical SMILES for sodium;2-methylprop-2-enamide;propane is C=C(C)C(N)=O.C[CH-]C.[Na+].
What is the InChIKey of sodium;2-methylprop-2-enamide;propane?
The InChIKey is LDZVTKAWYWHWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C3H7.Na/c1-3(2)4(5)6;1-3-2;/h1H2,2H3,(H2,5,6);3H,1-2H3;/q;-1;+1.
What are the key properties of sodium;2-methylprop-2-enamide;propane?
sodium;2-methylprop-2-enamide;propane has a molecular weight of 151.18 g/mol, XLogP of -1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methylprop-2-enamide;propane is sourced from PubChem (CID 159451329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).