About (2R)-2-aminopropanoic acid;2-methylprop-2-enamide
(2R)-2-aminopropanoic acid;2-methylprop-2-enamide (PubChem CID 175865115) has the molecular formula C7H14N2O3
and a molecular weight of 174.20 g/mol. Its IUPAC name is (2R)-2-aminopropanoic acid;2-methylprop-2-enamide.
Molecular Properties
| Compound Name | (2R)-2-aminopropanoic acid;2-methylprop-2-enamide |
| PubChem CID | 175865115 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2R)-2-aminopropanoic acid;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H7NO.C3H7NO2/c1-3(2)4(5)6;1-2(4)3(5)6/h1H2,2H3,(H2,5,6);2H,4H2,1H3,(H,5,6)/t;2-/m.1/s1 |
| InChIKey | DOROBIZSZRTURB-ARGLLVQISA-N |
| XLogP | -0.53 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-aminopropanoic acid;2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-aminopropanoic acid;2-methylprop-2-enamide?
The IUPAC name of (2R)-2-aminopropanoic acid;2-methylprop-2-enamide (CID 175865115) is (2R)-2-aminopropanoic acid;2-methylprop-2-enamide.
What is the SMILES notation for (2R)-2-aminopropanoic acid;2-methylprop-2-enamide?
The canonical SMILES for (2R)-2-aminopropanoic acid;2-methylprop-2-enamide is C=C(C)C(N)=O.C[C@@H](N)C(=O)O.
What is the InChIKey of (2R)-2-aminopropanoic acid;2-methylprop-2-enamide?
The InChIKey is DOROBIZSZRTURB-ARGLLVQISA-N. The full InChI is InChI=1S/C4H7NO.C3H7NO2/c1-3(2)4(5)6;1-2(4)3(5)6/h1H2,2H3,(H2,5,6);2H,4H2,1H3,(H,5,6)/t;2-/m.1/s1.
What are the key properties of (2R)-2-aminopropanoic acid;2-methylprop-2-enamide?
(2R)-2-aminopropanoic acid;2-methylprop-2-enamide has a molecular weight of 174.20 g/mol, XLogP of -0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminopropanoic acid;2-methylprop-2-enamide is sourced from PubChem (CID 175865115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).