About acetic acid;2-aminopropanoic acid;azane
acetic acid;2-aminopropanoic acid;azane (PubChem CID 175391326) has the molecular formula C9H22N2O8
and a molecular weight of 286.28 g/mol. Its IUPAC name is acetic acid;2-aminopropanoic acid;azane.
Molecular Properties
| Compound Name | acetic acid;2-aminopropanoic acid;azane |
| PubChem CID | 175391326 |
| Molecular Formula | C9H22N2O8 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | acetic acid;2-aminopropanoic acid;azane |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(N)C(=O)O.N |
| InChI | InChI=1S/C3H7NO2.3C2H4O2.H3N/c1-2(4)3(5)6;3*1-2(3)4;/h2H,4H2,1H3,(H,5,6);3*1H3,(H,3,4);1H3 |
| InChIKey | JKSYCZBKSSSMKI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze acetic acid;2-aminopropanoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-aminopropanoic acid;azane?
The IUPAC name of acetic acid;2-aminopropanoic acid;azane (CID 175391326) is acetic acid;2-aminopropanoic acid;azane.
What is the SMILES notation for acetic acid;2-aminopropanoic acid;azane?
The canonical SMILES for acetic acid;2-aminopropanoic acid;azane is CC(=O)O.CC(=O)O.CC(=O)O.CC(N)C(=O)O.N.
What is the InChIKey of acetic acid;2-aminopropanoic acid;azane?
The InChIKey is JKSYCZBKSSSMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.3C2H4O2.H3N/c1-2(4)3(5)6;3*1-2(3)4;/h2H,4H2,1H3,(H,5,6);3*1H3,(H,3,4);1H3.
What are the key properties of acetic acid;2-aminopropanoic acid;azane?
acetic acid;2-aminopropanoic acid;azane has a molecular weight of 286.28 g/mol, XLogP of -0.15, 1 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-aminopropanoic acid;azane is sourced from PubChem (CID 175391326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).