acetic acid;2-aminopropanoic acid;azane

C9H22N2O8 — CID 175391326

IUPACacetic acid;2-aminopropanoic acid;azane
SMILESCC(=O)O.CC(=O)O.CC(=O)O.CC(N)C(=O)O.N
InChIInChI=1S/C3H7NO2.3C2H4O2.H3N/c1-2(4)3(5)6;3*1-2(3)4;/h2H,4H2,1H3,(H,5,6);3*1H3,(H,3,4);1H3
InChIKeyJKSYCZBKSSSMKI-UHFFFAOYSA-N
MW286.28 g/mol
LogP-0.15
Rot. Bonds1

About acetic acid;2-aminopropanoic acid;azane

acetic acid;2-aminopropanoic acid;azane (PubChem CID 175391326) has the molecular formula C9H22N2O8 and a molecular weight of 286.28 g/mol. Its IUPAC name is acetic acid;2-aminopropanoic acid;azane.

Molecular Properties

Compound Nameacetic acid;2-aminopropanoic acid;azane
PubChem CID175391326
Molecular FormulaC9H22N2O8
Molecular Weight286.28 g/mol
Exact Mass286.14
IUPAC Nameacetic acid;2-aminopropanoic acid;azane
SMILESCC(=O)O.CC(=O)O.CC(=O)O.CC(N)C(=O)O.N
InChIInChI=1S/C3H7NO2.3C2H4O2.H3N/c1-2(4)3(5)6;3*1-2(3)4;/h2H,4H2,1H3,(H,5,6);3*1H3,(H,3,4);1H3
InChIKeyJKSYCZBKSSSMKI-UHFFFAOYSA-N
XLogP-0.15
TPSA210.22 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500286.28
LogP ≤ 5-0.15
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Analyze acetic acid;2-aminopropanoic acid;azane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-aminopropanoic acid;azane?
The IUPAC name of acetic acid;2-aminopropanoic acid;azane (CID 175391326) is acetic acid;2-aminopropanoic acid;azane.
What is the SMILES notation for acetic acid;2-aminopropanoic acid;azane?
The canonical SMILES for acetic acid;2-aminopropanoic acid;azane is CC(=O)O.CC(=O)O.CC(=O)O.CC(N)C(=O)O.N.
What is the InChIKey of acetic acid;2-aminopropanoic acid;azane?
The InChIKey is JKSYCZBKSSSMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.3C2H4O2.H3N/c1-2(4)3(5)6;3*1-2(3)4;/h2H,4H2,1H3,(H,5,6);3*1H3,(H,3,4);1H3.
What are the key properties of acetic acid;2-aminopropanoic acid;azane?
acetic acid;2-aminopropanoic acid;azane has a molecular weight of 286.28 g/mol, XLogP of -0.15, 1 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-aminopropanoic acid;azane is sourced from PubChem (CID 175391326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).