C10H23NO4 — CID 135223256
ethane-1,2-diol;ethoxyethane;2-methylprop-2-enamide (PubChem CID 135223256) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is ethane-1,2-diol;ethoxyethane;2-methylprop-2-enamide.
| Compound Name | ethane-1,2-diol;ethoxyethane;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 135223256 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | ethane-1,2-diol;ethoxyethane;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.CCOCC.OCCO |
| InChI | InChI=1S/C4H7NO.C4H10O.C2H6O2/c1-3(2)4(5)6;1-3-5-4-2;3-1-2-4/h1H2,2H3,(H2,5,6);3-4H2,1-2H3;3-4H,1-2H2 |
| InChIKey | WTUVDBLQDIJROR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|