C9H14NNaO4S — CID 175518990
sodium;2-methylidenepent-4-enamide;prop-2-ene-1-sulfonate (PubChem CID 175518990) has the molecular formula C9H14NNaO4S and a molecular weight of 255.27 g/mol. Its IUPAC name is sodium;2-methylidenepent-4-enamide;prop-2-ene-1-sulfonate.
| Compound Name | sodium;2-methylidenepent-4-enamide;prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 175518990 |
| Molecular Formula | C9H14NNaO4S |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | sodium;2-methylidenepent-4-enamide;prop-2-ene-1-sulfonate |
| SMILES | C=CCC(=C)C(N)=O.C=CCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H9NO.C3H6O3S.Na/c1-3-4-5(2)6(7)8;1-2-3-7(4,5)6;/h3H,1-2,4H2,(H2,7,8);2H,1,3H2,(H,4,5,6);/q;;+1/p-1 |
| InChIKey | VYVVVSWHBJFFGN-UHFFFAOYSA-M |
| XLogP | -2.67 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|