About prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene
prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene (PubChem CID 89307077) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene.
Molecular Properties
| Compound Name | prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene |
| PubChem CID | 89307077 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene |
| SMILES | C=CC(N)=O.C=CCS(=O)(=O)CC=C |
| InChI | InChI=1S/C6H10O2S.C3H5NO/c1-3-5-9(7,8)6-4-2;1-2-3(4)5/h3-4H,1-2,5-6H2;2H,1H2,(H2,4,5) |
| InChIKey | DRUQQFMSUSSEEZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene?
The IUPAC name of prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene (CID 89307077) is prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene.
What is the SMILES notation for prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene?
The canonical SMILES for prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene is C=CC(N)=O.C=CCS(=O)(=O)CC=C.
What is the InChIKey of prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene?
The InChIKey is DRUQQFMSUSSEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S.C3H5NO/c1-3-5-9(7,8)6-4-2;1-2-3(4)5/h3-4H,1-2,5-6H2;2H,1H2,(H2,4,5).
What are the key properties of prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene?
prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene has a molecular weight of 217.29 g/mol, XLogP of 0.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enamide;3-prop-2-enylsulfonylprop-1-ene is sourced from PubChem (CID 89307077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).