C5H9NaO3S — CID 174838535
sodium;ethene;prop-2-ene-1-sulfonate (PubChem CID 174838535) has the molecular formula C5H9NaO3S and a molecular weight of 172.18 g/mol. Its IUPAC name is sodium;ethene;prop-2-ene-1-sulfonate.
| Compound Name | sodium;ethene;prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 174838535 |
| Molecular Formula | C5H9NaO3S |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | sodium;ethene;prop-2-ene-1-sulfonate |
| SMILES | C=C.C=CCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3S.C2H4.Na/c1-2-3-7(4,5)6;1-2;/h2H,1,3H2,(H,4,5,6);1-2H2;/q;;+1/p-1 |
| InChIKey | LEDBWNVZWHLJNG-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|