C10H21NO3S — CID 88537317
1,1-dimethylpiperidin-1-ium;prop-2-ene-1-sulfonate (PubChem CID 88537317) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 1,1-dimethylpiperidin-1-ium;prop-2-ene-1-sulfonate.
| Compound Name | 1,1-dimethylpiperidin-1-ium;prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 88537317 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1,1-dimethylpiperidin-1-ium;prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)[O-].C[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C7H16N.C3H6O3S/c1-8(2)6-4-3-5-7-8;1-2-3-7(4,5)6/h3-7H2,1-2H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | IJPZENWSZNXUDL-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|