C13H27NO4S — CID 88537392
4,4-dipropylmorpholin-4-ium;prop-2-ene-1-sulfonate (PubChem CID 88537392) has the molecular formula C13H27NO4S and a molecular weight of 293.43 g/mol. Its IUPAC name is 4,4-dipropylmorpholin-4-ium;prop-2-ene-1-sulfonate.
| Compound Name | 4,4-dipropylmorpholin-4-ium;prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 88537392 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 4,4-dipropylmorpholin-4-ium;prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)[O-].CCC[N+]1(CCC)CCOCC1 |
| InChI | InChI=1S/C10H22NO.C3H6O3S/c1-3-5-11(6-4-2)7-9-12-10-8-11;1-2-3-7(4,5)6/h3-10H2,1-2H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | XTCCIVLKIWEQEP-UHFFFAOYSA-M |
| XLogP | 1.37 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|