C11H23NO4S — CID 88537086
4-methyl-4-propylmorpholin-4-ium;prop-2-ene-1-sulfonate (PubChem CID 88537086) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-methyl-4-propylmorpholin-4-ium;prop-2-ene-1-sulfonate.
| Compound Name | 4-methyl-4-propylmorpholin-4-ium;prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 88537086 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-methyl-4-propylmorpholin-4-ium;prop-2-ene-1-sulfonate |
| SMILES | C=CCS(=O)(=O)[O-].CCC[N+]1(C)CCOCC1 |
| InChI | InChI=1S/C8H18NO.C3H6O3S/c1-3-4-9(2)5-7-10-8-6-9;1-2-3-7(4,5)6/h3-8H2,1-2H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | ZITVSFMCORFOCM-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|