C7H17NO4S — CID 87311376
4,4-dimethylmorpholin-4-ium;methanesulfonate (PubChem CID 87311376) has the molecular formula C7H17NO4S and a molecular weight of 211.28 g/mol. Its IUPAC name is 4,4-dimethylmorpholin-4-ium;methanesulfonate.
| Compound Name | 4,4-dimethylmorpholin-4-ium;methanesulfonate |
|---|---|
| PubChem CID | 87311376 |
| Molecular Formula | C7H17NO4S |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4,4-dimethylmorpholin-4-ium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].C[N+]1(C)CCOCC1 |
| InChI | InChI=1S/C6H14NO.CH4O3S/c1-7(2)3-5-8-6-4-7;1-5(2,3)4/h3-6H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | QMHVAJIWVGMSJM-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|