C48H108N6+6 — CID 158814736
1,1,8,8-tetramethyl-1,8-diazoniacyclotetradecane (PubChem CID 158814736) has the molecular formula C48H108N6+6 and a molecular weight of 769.43 g/mol. Its IUPAC name is 1,1,8,8-tetramethyl-1,8-diazoniacyclotetradecane.
| Compound Name | 1,1,8,8-tetramethyl-1,8-diazoniacyclotetradecane |
|---|---|
| PubChem CID | 158814736 |
| Molecular Formula | C48H108N6+6 |
| Molecular Weight | 769.43 g/mol |
| Exact Mass | 768.86 |
| IUPAC Name | 1,1,8,8-tetramethyl-1,8-diazoniacyclotetradecane |
| SMILES | C[N+]1(C)CCCCCC[N+](C)(C)CCCCCC1.C[N+]1(C)CCCCCC[N+](C)(C)CCCCCC1.C[N+]1(C)CCCCCC[N+](C)(C)CCCCCC1 |
| InChI | InChI=1S/3C16H36N2/c3*1-17(2)13-9-5-7-11-15-18(3,4)16-12-8-6-10-14-17/h3*5-16H2,1-4H3/q3*+2 |
| InChIKey | IVCVPGDZZZAWKH-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.43 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|