C10H23ClN+ — CID 159746860
1-chloropropane;1,1-dimethylpiperidin-1-ium (PubChem CID 159746860) has the molecular formula C10H23ClN+ and a molecular weight of 192.75 g/mol. Its IUPAC name is 1-chloropropane;1,1-dimethylpiperidin-1-ium.
| Compound Name | 1-chloropropane;1,1-dimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 159746860 |
| Molecular Formula | C10H23ClN+ |
| Molecular Weight | 192.75 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-chloropropane;1,1-dimethylpiperidin-1-ium |
| SMILES | CCCCl.C[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C7H16N.C3H7Cl/c1-8(2)6-4-3-5-7-8;1-2-3-4/h3-7H2,1-2H3;2-3H2,1H3/q+1; |
| InChIKey | ZPVRSOSYTWMCLL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|