About 1,1-dimethylazetidin-1-ium;dihydroiodide
1,1-dimethylazetidin-1-ium;dihydroiodide (PubChem CID 146173684) has the molecular formula C5H14I2N+
and a molecular weight of 341.98 g/mol. Its IUPAC name is 1,1-dimethylazetidin-1-ium;dihydroiodide.
Molecular Properties
| Compound Name | 1,1-dimethylazetidin-1-ium;dihydroiodide |
| PubChem CID | 146173684 |
| Molecular Formula | C5H14I2N+ |
| Molecular Weight | 341.98 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | 1,1-dimethylazetidin-1-ium;dihydroiodide |
| SMILES | C[N+]1(C)CCC1.I.I |
| InChI | InChI=1S/C5H12N.2HI/c1-6(2)4-3-5-6;;/h3-5H2,1-2H3;2*1H/q+1;; |
| InChIKey | HCVCPWPRPCFJHV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.98 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethylazetidin-1-ium;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylazetidin-1-ium;dihydroiodide?
The IUPAC name of 1,1-dimethylazetidin-1-ium;dihydroiodide (CID 146173684) is 1,1-dimethylazetidin-1-ium;dihydroiodide.
What is the SMILES notation for 1,1-dimethylazetidin-1-ium;dihydroiodide?
The canonical SMILES for 1,1-dimethylazetidin-1-ium;dihydroiodide is C[N+]1(C)CCC1.I.I.
What is the InChIKey of 1,1-dimethylazetidin-1-ium;dihydroiodide?
The InChIKey is HCVCPWPRPCFJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N.2HI/c1-6(2)4-3-5-6;;/h3-5H2,1-2H3;2*1H/q+1;;.
What are the key properties of 1,1-dimethylazetidin-1-ium;dihydroiodide?
1,1-dimethylazetidin-1-ium;dihydroiodide has a molecular weight of 341.98 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylazetidin-1-ium;dihydroiodide is sourced from PubChem (CID 146173684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).