C5H14I2N+ — CID 146173684
1,1-dimethylazetidin-1-ium;dihydroiodide (PubChem CID 146173684) has the molecular formula C5H14I2N+ and a molecular weight of 341.98 g/mol. Its IUPAC name is 1,1-dimethylazetidin-1-ium;dihydroiodide.
| Compound Name | 1,1-dimethylazetidin-1-ium;dihydroiodide |
|---|---|
| PubChem CID | 146173684 |
| Molecular Formula | C5H14I2N+ |
| Molecular Weight | 341.98 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | 1,1-dimethylazetidin-1-ium;dihydroiodide |
| SMILES | C[N+]1(C)CCC1.I.I |
| InChI | InChI=1S/C5H12N.2HI/c1-6(2)4-3-5-6;;/h3-5H2,1-2H3;2*1H/q+1;; |
| InChIKey | HCVCPWPRPCFJHV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.98 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|