C9H22NU+ — CID 171513680
1,1-dimethylpiperidin-1-ium;ethane;uranium (PubChem CID 171513680) has the molecular formula C9H22NU+ and a molecular weight of 382.31 g/mol. Its IUPAC name is 1,1-dimethylpiperidin-1-ium;ethane;uranium.
| Compound Name | 1,1-dimethylpiperidin-1-ium;ethane;uranium |
|---|---|
| PubChem CID | 171513680 |
| Molecular Formula | C9H22NU+ |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1,1-dimethylpiperidin-1-ium;ethane;uranium |
| SMILES | CC.C[N+]1(C)CCCCC1.[U] |
| InChI | InChI=1S/C7H16N.C2H6.U/c1-8(2)6-4-3-5-7-8;1-2;/h3-7H2,1-2H3;1-2H3;/q+1;; |
| InChIKey | WKKPGXPJFYTDCX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|