C12H26IN — CID 121010935
1,1-dimethyl-azoniacycloundecane iodide (PubChem CID 121010935) has the molecular formula C12H26IN and a molecular weight of 311.25 g/mol. Its IUPAC name is 1,1-dimethyl-azoniacycloundecane iodide.
| Compound Name | 1,1-dimethyl-azoniacycloundecane iodide |
|---|---|
| PubChem CID | 121010935 |
| Molecular Formula | C12H26IN |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1,1-dimethyl-azoniacycloundecane iodide |
| SMILES | C[N+]1(C)CCCCCCCCCC1.[I-] |
| InChI | InChI=1S/C12H26N.HI/c1-13(2)11-9-7-5-3-4-6-8-10-12-13;/h3-12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | DXDLQKVIMBCXFE-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|