C7H18BF4NO — CID 175569580
1,1-dimethylpyrrolidin-1-ium;methanol;tetrafluoroborate (PubChem CID 175569580) has the molecular formula C7H18BF4NO and a molecular weight of 219.03 g/mol. Its IUPAC name is 1,1-dimethylpyrrolidin-1-ium;methanol;tetrafluoroborate.
| Compound Name | 1,1-dimethylpyrrolidin-1-ium;methanol;tetrafluoroborate |
|---|---|
| PubChem CID | 175569580 |
| Molecular Formula | C7H18BF4NO |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1,1-dimethylpyrrolidin-1-ium;methanol;tetrafluoroborate |
| SMILES | CO.C[N+]1(C)CCCC1.F[B-](F)(F)F |
| InChI | InChI=1S/C6H14N.CH4O.BF4/c1-7(2)5-3-4-6-7;1-2;2-1(3,4)5/h3-6H2,1-2H3;2H,1H3;/q+1;;-1 |
| InChIKey | AFAZDTAAIHYOCW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|