C16H30N2O4 — CID 70360430
(Z)-but-2-enedioate;bis(1,1-dimethylpyrrolidin-1-ium) (PubChem CID 70360430) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is (Z)-but-2-enedioate;bis(1,1-dimethylpyrrolidin-1-ium).
| Compound Name | (Z)-but-2-enedioate;bis(1,1-dimethylpyrrolidin-1-ium) |
|---|---|
| PubChem CID | 70360430 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (Z)-but-2-enedioate;bis(1,1-dimethylpyrrolidin-1-ium) |
| SMILES | C[N+]1(C)CCCC1.C[N+]1(C)CCCC1.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/2C6H14N.C4H4O4/c2*1-7(2)5-3-4-6-7;5-3(6)1-2-4(7)8/h2*3-6H2,1-2H3;1-2H,(H,5,6)(H,7,8)/q2*+1;/p-2/b;;2-1- |
| InChIKey | XJHJVUHFFASAGS-KSBRXOFISA-L |
| XLogP | -1.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|