C8H14F6N2O4S2 — CID 141312811
bis(trifluoromethylsulfonyl)azanide;1,1-dimethylpyrrolidin-1-ium (PubChem CID 141312811) has the molecular formula C8H14F6N2O4S2 and a molecular weight of 380.33 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1,1-dimethylpyrrolidin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1,1-dimethylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 141312811 |
| Molecular Formula | C8H14F6N2O4S2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1,1-dimethylpyrrolidin-1-ium |
| SMILES | C[N+]1(C)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H14N.C2F6NO4S2/c1-7(2)5-3-4-6-7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-6H2,1-2H3;/q+1;-1 |
| InChIKey | BBBSSFZSOUYKLW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|