About CID 175985522
CID 175985522 (PubChem CID 175985522) has the molecular formula C11H20F6LiN2O4S2
and a molecular weight of 429.35 g/mol.
Molecular Properties
| Compound Name | CID 175985522 |
| PubChem CID | 175985522 |
| Molecular Formula | C11H20F6LiN2O4S2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | — |
| SMILES | CCCC[N+]1(C)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Li] |
| InChI | InChI=1S/C9H20N.C2F6NO4S2.Li/c1-3-4-7-10(2)8-5-6-9-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h3-9H2,1-2H3;;/q+1;-1; |
| InChIKey | CXKGIJBZSWXGGW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 175985522 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175985522?
The IUPAC name of CID 175985522 (CID 175985522) is not available.
What is the SMILES notation for CID 175985522?
The canonical SMILES for CID 175985522 is CCCC[N+]1(C)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Li].
What is the InChIKey of CID 175985522?
The InChIKey is CXKGIJBZSWXGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N.C2F6NO4S2.Li/c1-3-4-7-10(2)8-5-6-9-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h3-9H2,1-2H3;;/q+1;-1;.
What are the key properties of CID 175985522?
CID 175985522 has a molecular weight of 429.35 g/mol, XLogP of 2.71, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175985522 is sourced from PubChem (CID 175985522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).