C11H20F6LiN2O4S2 — CID 175985522
CID 175985522 (PubChem CID 175985522) has the molecular formula C11H20F6LiN2O4S2 and a molecular weight of 429.35 g/mol.
| Compound Name | CID 175985522 |
|---|---|
| PubChem CID | 175985522 |
| Molecular Formula | C11H20F6LiN2O4S2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | — |
| SMILES | CCCC[N+]1(C)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Li] |
| InChI | InChI=1S/C9H20N.C2F6NO4S2.Li/c1-3-4-7-10(2)8-5-6-9-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h3-9H2,1-2H3;;/q+1;-1; |
| InChIKey | CXKGIJBZSWXGGW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|