C14H17F7N2O4S2 — CID 62705237
bis(trifluoromethylsulfonyl)azanide;1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium (PubChem CID 62705237) has the molecular formula C14H17F7N2O4S2 and a molecular weight of 474.42 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 62705237 |
| Molecular Formula | C14H17F7N2O4S2 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium |
| SMILES | C[N+]1(Cc2ccccc2F)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17FN.C2F6NO4S2/c1-14(8-4-5-9-14)10-11-6-2-3-7-12(11)13;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-3,6-7H,4-5,8-10H2,1H3;/q+1;-1 |
| InChIKey | ZLBYSAPUMSQJFI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|