C13H17FO4S — CID 82183265
2-ethyl-2-[(2-fluorophenyl)methylsulfonyl]butanoic acid (PubChem CID 82183265) has the molecular formula C13H17FO4S and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-ethyl-2-[(2-fluorophenyl)methylsulfonyl]butanoic acid.
| Compound Name | 2-ethyl-2-[(2-fluorophenyl)methylsulfonyl]butanoic acid |
|---|---|
| PubChem CID | 82183265 |
| Molecular Formula | C13H17FO4S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-ethyl-2-[(2-fluorophenyl)methylsulfonyl]butanoic acid |
| SMILES | CCC(CC)(C(=O)O)S(=O)(=O)Cc1ccccc1F |
| InChI | InChI=1S/C13H17FO4S/c1-3-13(4-2,12(15)16)19(17,18)9-10-7-5-6-8-11(10)14/h5-8H,3-4,9H2,1-2H3,(H,15,16) |
| InChIKey | UVZKJZQFNOCBEN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |