About bis(trifluoromethylsulfonyl)azanide;uranium
bis(trifluoromethylsulfonyl)azanide;uranium (PubChem CID 162552088) has the molecular formula C2F6NO4S2U-
and a molecular weight of 518.18 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;uranium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;uranium |
| PubChem CID | 162552088 |
| Molecular Formula | C2F6NO4S2U- |
| Molecular Weight | 518.18 g/mol |
| Exact Mass | 517.97 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;uranium |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[U] |
| InChI | InChI=1S/C2F6NO4S2.U/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1; |
| InChIKey | DPMNFUQLAXEDLD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(trifluoromethylsulfonyl)azanide;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;uranium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;uranium (CID 162552088) is bis(trifluoromethylsulfonyl)azanide;uranium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;uranium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;uranium is O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[U].
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;uranium?
The InChIKey is DPMNFUQLAXEDLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F6NO4S2.U/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/q-1;.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;uranium?
bis(trifluoromethylsulfonyl)azanide;uranium has a molecular weight of 518.18 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;uranium is sourced from PubChem (CID 162552088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).