C3F9NO2S3 — CID 23235790
1,1,1-trifluoro-N,N-bis(trifluoromethylsulfanyl)methanesulfonamide (PubChem CID 23235790) has the molecular formula C3F9NO2S3 and a molecular weight of 349.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-N,N-bis(trifluoromethylsulfanyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N,N-bis(trifluoromethylsulfanyl)methanesulfonamide |
|---|---|
| PubChem CID | 23235790 |
| Molecular Formula | C3F9NO2S3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.89 |
| IUPAC Name | 1,1,1-trifluoro-N,N-bis(trifluoromethylsulfanyl)methanesulfonamide |
| SMILES | O=S(=O)(N(SC(F)(F)F)SC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3F9NO2S3/c4-1(5,6)16-13(17-2(7,8)9)18(14,15)3(10,11)12 |
| InChIKey | BZNPLDVTUNHGHC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|