C27H31FINO — CID 3061828
2-[1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]-1,3-diphenylpropan-2-ol iodide (PubChem CID 3061828) has the molecular formula C27H31FINO and a molecular weight of 531.45 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]-1,3-diphenylpropan-2-ol iodide.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]-1,3-diphenylpropan-2-ol iodide |
|---|---|
| PubChem CID | 3061828 |
| Molecular Formula | C27H31FINO |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]-1,3-diphenylpropan-2-ol iodide |
| SMILES | C[N+]1(Cc2ccccc2F)CCCC1C(O)(Cc1ccccc1)Cc1ccccc1.[I-] |
| InChI | InChI=1S/C27H31FNO.HI/c1-29(21-24-15-8-9-16-25(24)28)18-10-17-26(29)27(30,19-22-11-4-2-5-12-22)20-23-13-6-3-7-14-23;/h2-9,11-16,26,30H,10,17-21H2,1H3;1H/q+1;/p-1 |
| InChIKey | FXPQYAUSYPDYSF-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|