C10H20F6N2O6S2 — CID 87842553
1,1,4,4-tetramethylpiperazine-1,4-diium;bis(trifluoromethanesulfonate) (PubChem CID 87842553) has the molecular formula C10H20F6N2O6S2 and a molecular weight of 442.40 g/mol. Its IUPAC name is 1,1,4,4-tetramethylpiperazine-1,4-diium;bis(trifluoromethanesulfonate).
| Compound Name | 1,1,4,4-tetramethylpiperazine-1,4-diium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 87842553 |
| Molecular Formula | C10H20F6N2O6S2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 1,1,4,4-tetramethylpiperazine-1,4-diium;bis(trifluoromethanesulfonate) |
| SMILES | C[N+]1(C)CC[N+](C)(C)CC1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C8H20N2.2CHF3O3S/c1-9(2)5-7-10(3,4)8-6-9;2*2-1(3,4)8(5,6)7/h5-8H2,1-4H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | ABMLVFMXJSKIHK-UHFFFAOYSA-L |
| XLogP | 0.26 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|