C12H25F3N2O4S2 — CID 157458632
1,2-dimethyl-1-propylpiperidin-1-ium;methylsulfonyl(trifluoromethylsulfonyl)azanide (PubChem CID 157458632) has the molecular formula C12H25F3N2O4S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 1,2-dimethyl-1-propylpiperidin-1-ium;methylsulfonyl(trifluoromethylsulfonyl)azanide.
| Compound Name | 1,2-dimethyl-1-propylpiperidin-1-ium;methylsulfonyl(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 157458632 |
| Molecular Formula | C12H25F3N2O4S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1,2-dimethyl-1-propylpiperidin-1-ium;methylsulfonyl(trifluoromethylsulfonyl)azanide |
| SMILES | CCC[N+]1(C)CCCCC1C.CS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H22N.C2H3F3NO4S2/c1-4-8-11(3)9-6-5-7-10(11)2;1-11(7,8)6-12(9,10)2(3,4)5/h10H,4-9H2,1-3H3;1H3/q+1;-1 |
| InChIKey | BTQUWXMPAVMWJW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|