C18H40N2+2 — CID 161031580
1-butyl-1,2-dimethylpyrrolidin-1-ium;1-methyl-1-propylpyrrolidin-1-ium (PubChem CID 161031580) has the molecular formula C18H40N2+2 and a molecular weight of 284.53 g/mol. Its IUPAC name is 1-butyl-1,2-dimethylpyrrolidin-1-ium;1-methyl-1-propylpyrrolidin-1-ium.
| Compound Name | 1-butyl-1,2-dimethylpyrrolidin-1-ium;1-methyl-1-propylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 161031580 |
| Molecular Formula | C18H40N2+2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | 1-butyl-1,2-dimethylpyrrolidin-1-ium;1-methyl-1-propylpyrrolidin-1-ium |
| SMILES | CCCC[N+]1(C)CCCC1C.CCC[N+]1(C)CCCC1 |
| InChI | InChI=1S/C10H22N.C8H18N/c1-4-5-8-11(3)9-6-7-10(11)2;1-3-6-9(2)7-4-5-8-9/h10H,4-9H2,1-3H3;3-8H2,1-2H3/q2*+1 |
| InChIKey | TZROXPJKRWVHCQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|