C11H26N+ — CID 159441399
1,3-dimethyl-1-propylpiperidin-1-ium;methane (PubChem CID 159441399) has the molecular formula C11H26N+ and a molecular weight of 172.34 g/mol. Its IUPAC name is 1,3-dimethyl-1-propylpiperidin-1-ium;methane.
| Compound Name | 1,3-dimethyl-1-propylpiperidin-1-ium;methane |
|---|---|
| PubChem CID | 159441399 |
| Molecular Formula | C11H26N+ |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.21 |
| IUPAC Name | 1,3-dimethyl-1-propylpiperidin-1-ium;methane |
| SMILES | C.CCC[N+]1(C)CCCC(C)C1 |
| InChI | InChI=1S/C10H22N.CH4/c1-4-7-11(3)8-5-6-10(2)9-11;/h10H,4-9H2,1-3H3;1H4/q+1; |
| InChIKey | LSFJXRQDZSMWAK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|