About 1,3-dimethyl-1-propylpiperidin-1-ium;methane
1,3-dimethyl-1-propylpiperidin-1-ium;methane (PubChem CID 159441399) has the molecular formula C11H26N+
and a molecular weight of 172.34 g/mol. Its IUPAC name is 1,3-dimethyl-1-propylpiperidin-1-ium;methane.
Molecular Properties
| Compound Name | 1,3-dimethyl-1-propylpiperidin-1-ium;methane |
| PubChem CID | 159441399 |
| Molecular Formula | C11H26N+ |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.21 |
| IUPAC Name | 1,3-dimethyl-1-propylpiperidin-1-ium;methane |
| SMILES | C.CCC[N+]1(C)CCCC(C)C1 |
| InChI | InChI=1S/C10H22N.CH4/c1-4-7-11(3)8-5-6-10(2)9-11;/h10H,4-9H2,1-3H3;1H4/q+1; |
| InChIKey | LSFJXRQDZSMWAK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-1-propylpiperidin-1-ium;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1-propylpiperidin-1-ium;methane?
The IUPAC name of 1,3-dimethyl-1-propylpiperidin-1-ium;methane (CID 159441399) is 1,3-dimethyl-1-propylpiperidin-1-ium;methane.
What is the SMILES notation for 1,3-dimethyl-1-propylpiperidin-1-ium;methane?
The canonical SMILES for 1,3-dimethyl-1-propylpiperidin-1-ium;methane is C.CCC[N+]1(C)CCCC(C)C1.
What is the InChIKey of 1,3-dimethyl-1-propylpiperidin-1-ium;methane?
The InChIKey is LSFJXRQDZSMWAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N.CH4/c1-4-7-11(3)8-5-6-10(2)9-11;/h10H,4-9H2,1-3H3;1H4/q+1;.
What are the key properties of 1,3-dimethyl-1-propylpiperidin-1-ium;methane?
1,3-dimethyl-1-propylpiperidin-1-ium;methane has a molecular weight of 172.34 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1-propylpiperidin-1-ium;methane is sourced from PubChem (CID 159441399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).