C13H26INOS — CID 71414368
S-[2-(1,3-dimethylpiperidin-1-ium-1-yl)ethyl] butanethioate iodide (PubChem CID 71414368) has the molecular formula C13H26INOS and a molecular weight of 371.33 g/mol. Its IUPAC name is S-[2-(1,3-dimethylpiperidin-1-ium-1-yl)ethyl] butanethioate iodide.
| Compound Name | S-[2-(1,3-dimethylpiperidin-1-ium-1-yl)ethyl] butanethioate iodide |
|---|---|
| PubChem CID | 71414368 |
| Molecular Formula | C13H26INOS |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | S-[2-(1,3-dimethylpiperidin-1-ium-1-yl)ethyl] butanethioate iodide |
| SMILES | CCCC(=O)SCC[N+]1(C)CCCC(C)C1.[I-] |
| InChI | InChI=1S/C13H26NOS.HI/c1-4-6-13(15)16-10-9-14(3)8-5-7-12(2)11-14;/h12H,4-11H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LDFRYRJRLAISSF-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|