About 1-methyl-1,4,4-tripropylpiperazine-1,4-diium
1-methyl-1,4,4-tripropylpiperazine-1,4-diium (PubChem CID 102468599) has the molecular formula C14H32N2+2
and a molecular weight of 228.42 g/mol. Its IUPAC name is 1-methyl-1,4,4-tripropylpiperazine-1,4-diium.
Molecular Properties
| Compound Name | 1-methyl-1,4,4-tripropylpiperazine-1,4-diium |
| PubChem CID | 102468599 |
| Molecular Formula | C14H32N2+2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 1-methyl-1,4,4-tripropylpiperazine-1,4-diium |
| SMILES | CCC[N+]1(C)CC[N+](CCC)(CCC)CC1 |
| InChI | InChI=1S/C14H32N2/c1-5-8-15(4)11-13-16(9-6-2,10-7-3)14-12-15/h5-14H2,1-4H3/q+2 |
| InChIKey | QRSDDZSYBJEXFK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1,4,4-tripropylpiperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,4,4-tripropylpiperazine-1,4-diium?
The IUPAC name of 1-methyl-1,4,4-tripropylpiperazine-1,4-diium (CID 102468599) is 1-methyl-1,4,4-tripropylpiperazine-1,4-diium.
What is the SMILES notation for 1-methyl-1,4,4-tripropylpiperazine-1,4-diium?
The canonical SMILES for 1-methyl-1,4,4-tripropylpiperazine-1,4-diium is CCC[N+]1(C)CC[N+](CCC)(CCC)CC1.
What is the InChIKey of 1-methyl-1,4,4-tripropylpiperazine-1,4-diium?
The InChIKey is QRSDDZSYBJEXFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2/c1-5-8-15(4)11-13-16(9-6-2,10-7-3)14-12-15/h5-14H2,1-4H3/q+2.
What are the key properties of 1-methyl-1,4,4-tripropylpiperazine-1,4-diium?
1-methyl-1,4,4-tripropylpiperazine-1,4-diium has a molecular weight of 228.42 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,4,4-tripropylpiperazine-1,4-diium is sourced from PubChem (CID 102468599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).