About 1,1-didecylaziridin-1-ium
1,1-didecylaziridin-1-ium (PubChem CID 87392693) has the molecular formula C22H46N+
and a molecular weight of 324.62 g/mol. Its IUPAC name is 1,1-didecylaziridin-1-ium.
Molecular Properties
| Compound Name | 1,1-didecylaziridin-1-ium |
| PubChem CID | 87392693 |
| Molecular Formula | C22H46N+ |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.36 |
| IUPAC Name | 1,1-didecylaziridin-1-ium |
| SMILES | CCCCCCCCCC[N+]1(CCCCCCCCCC)CC1 |
| InChI | InChI=1S/C22H46N/c1-3-5-7-9-11-13-15-17-19-23(21-22-23)20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3/q+1 |
| InChIKey | LKHMHBWZSFDRGJ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,1-didecylaziridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-didecylaziridin-1-ium?
The IUPAC name of 1,1-didecylaziridin-1-ium (CID 87392693) is 1,1-didecylaziridin-1-ium.
What is the SMILES notation for 1,1-didecylaziridin-1-ium?
The canonical SMILES for 1,1-didecylaziridin-1-ium is CCCCCCCCCC[N+]1(CCCCCCCCCC)CC1.
What is the InChIKey of 1,1-didecylaziridin-1-ium?
The InChIKey is LKHMHBWZSFDRGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46N/c1-3-5-7-9-11-13-15-17-19-23(21-22-23)20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3/q+1.
What are the key properties of 1,1-didecylaziridin-1-ium?
1,1-didecylaziridin-1-ium has a molecular weight of 324.62 g/mol, XLogP of 7.10, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-didecylaziridin-1-ium is sourced from PubChem (CID 87392693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).