C8H18N+ — CID 123689120
1-butyl-1,2-dimethylaziridin-1-ium (PubChem CID 123689120) has the molecular formula C8H18N+ and a molecular weight of 128.24 g/mol. Its IUPAC name is 1-butyl-1,2-dimethylaziridin-1-ium.
| Compound Name | 1-butyl-1,2-dimethylaziridin-1-ium |
|---|---|
| PubChem CID | 123689120 |
| Molecular Formula | C8H18N+ |
| Molecular Weight | 128.24 g/mol |
| Exact Mass | 128.14 |
| IUPAC Name | 1-butyl-1,2-dimethylaziridin-1-ium |
| SMILES | CCCC[N+]1(C)CC1C |
| InChI | InChI=1S/C8H18N/c1-4-5-6-9(3)7-8(9)2/h8H,4-7H2,1-3H3/q+1 |
| InChIKey | VWCTYEAZIDOKLY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|