C30H66N3+3 — CID 88637841
1,3,5-trimethyl-1,3,5-trioctyl-1,3,5-triazinane-1,3,5-triium (PubChem CID 88637841) has the molecular formula C30H66N3+3 and a molecular weight of 468.88 g/mol. Its IUPAC name is 1,3,5-trimethyl-1,3,5-trioctyl-1,3,5-triazinane-1,3,5-triium.
| Compound Name | 1,3,5-trimethyl-1,3,5-trioctyl-1,3,5-triazinane-1,3,5-triium |
|---|---|
| PubChem CID | 88637841 |
| Molecular Formula | C30H66N3+3 |
| Molecular Weight | 468.88 g/mol |
| Exact Mass | 468.52 |
| IUPAC Name | 1,3,5-trimethyl-1,3,5-trioctyl-1,3,5-triazinane-1,3,5-triium |
| SMILES | CCCCCCCC[N+]1(C)C[N+](C)(CCCCCCCC)C[N+](C)(CCCCCCCC)C1 |
| InChI | InChI=1S/C30H66N3/c1-7-10-13-16-19-22-25-31(4)28-32(5,26-23-20-17-14-11-8-2)30-33(6,29-31)27-24-21-18-15-12-9-3/h7-30H2,1-6H3/q+3 |
| InChIKey | PUXIXTSVWUNBRV-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.88 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|