C18H39N2+ — CID 68979496
1-dodecyl-1,4-dimethylpiperazin-1-ium (PubChem CID 68979496) has the molecular formula C18H39N2+ and a molecular weight of 283.52 g/mol. Its IUPAC name is 1-dodecyl-1,4-dimethylpiperazin-1-ium.
| Compound Name | 1-dodecyl-1,4-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 68979496 |
| Molecular Formula | C18H39N2+ |
| Molecular Weight | 283.52 g/mol |
| Exact Mass | 283.31 |
| IUPAC Name | 1-dodecyl-1,4-dimethylpiperazin-1-ium |
| SMILES | CCCCCCCCCCCC[N+]1(C)CCN(C)CC1 |
| InChI | InChI=1S/C18H39N2/c1-4-5-6-7-8-9-10-11-12-13-16-20(3)17-14-19(2)15-18-20/h4-18H2,1-3H3/q+1 |
| InChIKey | KIYSXQLVGAGQLK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|