C22H48N4+2 — CID 156599398
1-[10-(1,4-dimethylpiperazin-1-ium-1-yl)decyl]-1,4-dimethylpiperazin-1-ium (PubChem CID 156599398) has the molecular formula C22H48N4+2 and a molecular weight of 368.65 g/mol. Its IUPAC name is 1-[10-(1,4-dimethylpiperazin-1-ium-1-yl)decyl]-1,4-dimethylpiperazin-1-ium.
| Compound Name | 1-[10-(1,4-dimethylpiperazin-1-ium-1-yl)decyl]-1,4-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 156599398 |
| Molecular Formula | C22H48N4+2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.39 |
| IUPAC Name | 1-[10-(1,4-dimethylpiperazin-1-ium-1-yl)decyl]-1,4-dimethylpiperazin-1-ium |
| SMILES | CN1CC[N+](C)(CCCCCCCCCC[N+]2(C)CCN(C)CC2)CC1 |
| InChI | InChI=1S/C22H48N4/c1-23-13-19-25(3,20-14-23)17-11-9-7-5-6-8-10-12-18-26(4)21-15-24(2)16-22-26/h5-22H2,1-4H3/q+2 |
| InChIKey | SROYDOYEJVIAPJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|