C8H19ClN2O — CID 90239280
2-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol chloride (PubChem CID 90239280) has the molecular formula C8H19ClN2O and a molecular weight of 194.71 g/mol. Its IUPAC name is 2-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol chloride.
| Compound Name | 2-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol chloride |
|---|---|
| PubChem CID | 90239280 |
| Molecular Formula | C8H19ClN2O |
| Molecular Weight | 194.71 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-(1,4-dimethylpiperazin-1-ium-1-yl)ethanol chloride |
| SMILES | CN1CC[N+](C)(CCO)CC1.[Cl-] |
| InChI | InChI=1S/C8H19N2O.ClH/c1-9-3-5-10(2,6-4-9)7-8-11;/h11H,3-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NGSUBYGZKXXXFB-UHFFFAOYSA-M |
| XLogP | -3.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.71 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|